C19H28N4O3S — CID 25284688
4-[1-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]piperidin-4-yl]pyridine (PubChem CID 25284688) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is 4-[1-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]piperidin-4-yl]pyridine.
| Compound Name | 4-[1-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]piperidin-4-yl]pyridine |
|---|---|
| PubChem CID | 25284688 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 4-[1-[[3-(3-methoxypropyl)-2-methylsulfonylimidazol-4-yl]methyl]piperidin-4-yl]pyridine |
| SMILES | COCCCn1c(CN2CCC(c3ccncc3)CC2)cnc1S(C)(=O)=O |
| InChI | InChI=1S/C19H28N4O3S/c1-26-13-3-10-23-18(14-21-19(23)27(2,24)25)15-22-11-6-17(7-12-22)16-4-8-20-9-5-16/h4-5,8-9,14,17H,3,6-7,10-13,15H2,1-2H3 |
| InChIKey | WPLIAHOBFGGKGY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|