C18H25FN4O — CID 45185727
2-[1-[(4-fluorophenyl)methyl]-4-[(2-methyl-1H-imidazol-5-yl)methyl]piperazin-2-yl]ethanol (PubChem CID 45185727) has the molecular formula C18H25FN4O and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[1-[(4-fluorophenyl)methyl]-4-[(2-methyl-1H-imidazol-5-yl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[1-[(4-fluorophenyl)methyl]-4-[(2-methyl-1H-imidazol-5-yl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45185727 |
| Molecular Formula | C18H25FN4O |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[1-[(4-fluorophenyl)methyl]-4-[(2-methyl-1H-imidazol-5-yl)methyl]piperazin-2-yl]ethanol |
| SMILES | Cc1ncc(CN2CCN(Cc3ccc(F)cc3)C(CCO)C2)[nH]1 |
| InChI | InChI=1S/C18H25FN4O/c1-14-20-10-17(21-14)12-22-7-8-23(18(13-22)6-9-24)11-15-2-4-16(19)5-3-15/h2-5,10,18,24H,6-9,11-13H2,1H3,(H,20,21) |
| InChIKey | DHFIXOOLZTZKDY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |