C18H23FN2O — CID 45185934
N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]cyclopentene-1-carboxamide (PubChem CID 45185934) has the molecular formula C18H23FN2O and a molecular weight of 302.39 g/mol. Its IUPAC name is N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]cyclopentene-1-carboxamide.
| Compound Name | N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]cyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 45185934 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]cyclopentene-1-carboxamide |
| SMILES | O=C(NC1CCCN(Cc2ccccc2F)C1)C1=CCCC1 |
| InChI | InChI=1S/C18H23FN2O/c19-17-10-4-3-8-15(17)12-21-11-5-9-16(13-21)20-18(22)14-6-1-2-7-14/h3-4,6,8,10,16H,1-2,5,7,9,11-13H2,(H,20,22) |
| InChIKey | RTDGLECAEOTOEE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |