C19H27FN2O2 — CID 56892586
N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1-(methoxymethyl)cyclobutane-1-carboxamide (PubChem CID 56892586) has the molecular formula C19H27FN2O2 and a molecular weight of 334.43 g/mol. Its IUPAC name is N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1-(methoxymethyl)cyclobutane-1-carboxamide.
| Compound Name | N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1-(methoxymethyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 56892586 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-[1-[(2-fluorophenyl)methyl]piperidin-3-yl]-1-(methoxymethyl)cyclobutane-1-carboxamide |
| SMILES | COCC1(C(=O)NC2CCCN(Cc3ccccc3F)C2)CCC1 |
| InChI | InChI=1S/C19H27FN2O2/c1-24-14-19(9-5-10-19)18(23)21-16-7-4-11-22(13-16)12-15-6-2-3-8-17(15)20/h2-3,6,8,16H,4-5,7,9-14H2,1H3,(H,21,23) |
| InChIKey | LGGGBNNGRPKJLU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |