C16H26N4O4S — CID 45186799
4-[[3-(oxolan-2-ylmethyl)-2-propylsulfonylimidazol-4-yl]methyl]piperazin-2-one (PubChem CID 45186799) has the molecular formula C16H26N4O4S and a molecular weight of 370.48 g/mol. Its IUPAC name is 4-[[3-(oxolan-2-ylmethyl)-2-propylsulfonylimidazol-4-yl]methyl]piperazin-2-one.
| Compound Name | 4-[[3-(oxolan-2-ylmethyl)-2-propylsulfonylimidazol-4-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 45186799 |
| Molecular Formula | C16H26N4O4S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[[3-(oxolan-2-ylmethyl)-2-propylsulfonylimidazol-4-yl]methyl]piperazin-2-one |
| SMILES | CCCS(=O)(=O)c1ncc(CN2CCNC(=O)C2)n1CC1CCCO1 |
| InChI | InChI=1S/C16H26N4O4S/c1-2-8-25(22,23)16-18-9-13(10-19-6-5-17-15(21)12-19)20(16)11-14-4-3-7-24-14/h9,14H,2-8,10-12H2,1H3,(H,17,21) |
| InChIKey | KNICYLBMAWXPRM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |