C19H32N4O4S — CID 45179161
4-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]-3-ethylpiperazin-2-one (PubChem CID 45179161) has the molecular formula C19H32N4O4S and a molecular weight of 412.56 g/mol. Its IUPAC name is 4-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]-3-ethylpiperazin-2-one.
| Compound Name | 4-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]-3-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 45179161 |
| Molecular Formula | C19H32N4O4S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 4-[[2-cyclopentylsulfonyl-3-(3-methoxypropyl)imidazol-4-yl]methyl]-3-ethylpiperazin-2-one |
| SMILES | CCC1C(=O)NCCN1Cc1cnc(S(=O)(=O)C2CCCC2)n1CCCOC |
| InChI | InChI=1S/C19H32N4O4S/c1-3-17-18(24)20-9-11-22(17)14-15-13-21-19(23(15)10-6-12-27-2)28(25,26)16-7-4-5-8-16/h13,16-17H,3-12,14H2,1-2H3,(H,20,24) |
| InChIKey | QPKGIZADPDKBEV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|