C25H24N4O2 — CID 45187221
1-benzhydryl-N-(2-hydroxy-2-phenylethyl)-N-methyltriazole-4-carboxamide (PubChem CID 45187221) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-benzhydryl-N-(2-hydroxy-2-phenylethyl)-N-methyltriazole-4-carboxamide.
| Compound Name | 1-benzhydryl-N-(2-hydroxy-2-phenylethyl)-N-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 45187221 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-benzhydryl-N-(2-hydroxy-2-phenylethyl)-N-methyltriazole-4-carboxamide |
| SMILES | CN(CC(O)c1ccccc1)C(=O)c1cn(C(c2ccccc2)c2ccccc2)nn1 |
| InChI | InChI=1S/C25H24N4O2/c1-28(18-23(30)19-11-5-2-6-12-19)25(31)22-17-29(27-26-22)24(20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-17,23-24,30H,18H2,1H3 |
| InChIKey | GUYOCDQQRODAQA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |