C22H19N3O — CID 56649161
(1S,2S)-1,2-diphenyl-2-(4-phenyltriazol-1-yl)ethanol (PubChem CID 56649161) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is (1S,2S)-1,2-diphenyl-2-(4-phenyltriazol-1-yl)ethanol.
| Compound Name | (1S,2S)-1,2-diphenyl-2-(4-phenyltriazol-1-yl)ethanol |
|---|---|
| PubChem CID | 56649161 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (1S,2S)-1,2-diphenyl-2-(4-phenyltriazol-1-yl)ethanol |
| SMILES | O[C@@H](c1ccccc1)[C@H](c1ccccc1)n1cc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C22H19N3O/c26-22(19-14-8-3-9-15-19)21(18-12-6-2-7-13-18)25-16-20(23-24-25)17-10-4-1-5-11-17/h1-16,21-22,26H/t21-,22-/m0/s1 |
| InChIKey | PDSYDBIKZCLVTK-VXKWHMMOSA-N |
| XLogP | 4.27 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |