C23H30FN3O3 — CID 45190480
N-[(4-fluorophenyl)methyl]-3-[1-(5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl)piperidin-4-yl]propanamide (PubChem CID 45190480) has the molecular formula C23H30FN3O3 and a molecular weight of 415.51 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-[1-(5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-[1-(5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 45190480 |
| Molecular Formula | C23H30FN3O3 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-[1-(5-oxo-1-prop-2-enylpyrrolidine-3-carbonyl)piperidin-4-yl]propanamide |
| SMILES | C=CCN1CC(C(=O)N2CCC(CCC(=O)NCc3ccc(F)cc3)CC2)CC1=O |
| InChI | InChI=1S/C23H30FN3O3/c1-2-11-27-16-19(14-22(27)29)23(30)26-12-9-17(10-13-26)5-8-21(28)25-15-18-3-6-20(24)7-4-18/h2-4,6-7,17,19H,1,5,8-16H2,(H,25,28) |
| InChIKey | YYFKULHJBRRMSA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|