C26H25F2N3O — CID 45190662
(E)-3-(3,5-difluorophenyl)-1-[3-[2-methyl-5-(3-methylphenyl)pyrimidin-4-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 45190662) has the molecular formula C26H25F2N3O and a molecular weight of 433.50 g/mol. Its IUPAC name is (E)-3-(3,5-difluorophenyl)-1-[3-[2-methyl-5-(3-methylphenyl)pyrimidin-4-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-difluorophenyl)-1-[3-[2-methyl-5-(3-methylphenyl)pyrimidin-4-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 45190662 |
| Molecular Formula | C26H25F2N3O |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | (E)-3-(3,5-difluorophenyl)-1-[3-[2-methyl-5-(3-methylphenyl)pyrimidin-4-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | Cc1cccc(-c2cnc(C)nc2C2CCCN(C(=O)/C=C/c3cc(F)cc(F)c3)C2)c1 |
| InChI | InChI=1S/C26H25F2N3O/c1-17-5-3-6-20(11-17)24-15-29-18(2)30-26(24)21-7-4-10-31(16-21)25(32)9-8-19-12-22(27)14-23(28)13-19/h3,5-6,8-9,11-15,21H,4,7,10,16H2,1-2H3/b9-8+ |
| InChIKey | SISDRTOQNVZLIV-CMDGGOBGSA-N |
| XLogP | 5.46 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|