C29H24F2N4O — CID 74780750
3-(3-fluorophenyl)-1-[3-[5-(2-fluorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 74780750) has the molecular formula C29H24F2N4O and a molecular weight of 482.53 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-[3-[5-(2-fluorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3-fluorophenyl)-1-[3-[5-(2-fluorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 74780750 |
| Molecular Formula | C29H24F2N4O |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 3-(3-fluorophenyl)-1-[3-[5-(2-fluorophenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc(F)c1)N1CCCC(c2nc(-c3cccnc3)ncc2-c2ccccc2F)C1 |
| InChI | InChI=1S/C29H24F2N4O/c30-23-9-3-6-20(16-23)12-13-27(36)35-15-5-8-22(19-35)28-25(24-10-1-2-11-26(24)31)18-33-29(34-28)21-7-4-14-32-17-21/h1-4,6-7,9-14,16-18,22H,5,8,15,19H2 |
| InChIKey | OMMNYYVFWJNKPN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|