C28H23F3N4O — CID 42212179
[4-[5-(2-methylphenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]-(2,3,6-trifluorophenyl)methanone (PubChem CID 42212179) has the molecular formula C28H23F3N4O and a molecular weight of 488.51 g/mol. Its IUPAC name is [4-[5-(2-methylphenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]-(2,3,6-trifluorophenyl)methanone.
| Compound Name | [4-[5-(2-methylphenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]-(2,3,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 42212179 |
| Molecular Formula | C28H23F3N4O |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [4-[5-(2-methylphenyl)-2-pyridin-3-ylpyrimidin-4-yl]piperidin-1-yl]-(2,3,6-trifluorophenyl)methanone |
| SMILES | Cc1ccccc1-c1cnc(-c2cccnc2)nc1C1CCN(C(=O)c2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C28H23F3N4O/c1-17-5-2-3-7-20(17)21-16-33-27(19-6-4-12-32-15-19)34-26(21)18-10-13-35(14-11-18)28(36)24-22(29)8-9-23(30)25(24)31/h2-9,12,15-16,18H,10-11,13-14H2,1H3 |
| InChIKey | XDNVEUSGJUOLOG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|