C20H20N4O3S2 — CID 95798482
[4-(5-methylsulfonyl-2-pyridin-3-ylpyrimidin-4-yl)piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 95798482) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is [4-(5-methylsulfonyl-2-pyridin-3-ylpyrimidin-4-yl)piperidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(5-methylsulfonyl-2-pyridin-3-ylpyrimidin-4-yl)piperidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 95798482 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [4-(5-methylsulfonyl-2-pyridin-3-ylpyrimidin-4-yl)piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | CS(=O)(=O)c1cnc(-c2cccnc2)nc1C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H20N4O3S2/c1-29(26,27)17-13-22-19(15-4-2-8-21-12-15)23-18(17)14-6-9-24(10-7-14)20(25)16-5-3-11-28-16/h2-5,8,11-14H,6-7,9-10H2,1H3 |
| InChIKey | LJIMFBKVKYWTCA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |