C24H21N5OS — CID 46954762
[4-(2-pyridin-2-yl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 46954762) has the molecular formula C24H21N5OS and a molecular weight of 427.53 g/mol. Its IUPAC name is [4-(2-pyridin-2-yl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(2-pyridin-2-yl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 46954762 |
| Molecular Formula | C24H21N5OS |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [4-(2-pyridin-2-yl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC(c2nc(-c3ccccn3)ncc2-c2ccncc2)CC1 |
| InChI | InChI=1S/C24H21N5OS/c30-24(21-5-3-15-31-21)29-13-8-18(9-14-29)22-19(17-6-11-25-12-7-17)16-27-23(28-22)20-4-1-2-10-26-20/h1-7,10-12,15-16,18H,8-9,13-14H2 |
| InChIKey | SUZWXHIKQXMRPV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |