C30H37N3O2 — CID 45191112
1-[2-[2-[3-[[methyl(quinolin-8-ylmethyl)amino]methyl]phenoxy]ethyl]piperidin-1-yl]pent-4-en-1-one (PubChem CID 45191112) has the molecular formula C30H37N3O2 and a molecular weight of 471.65 g/mol. Its IUPAC name is 1-[2-[2-[3-[[methyl(quinolin-8-ylmethyl)amino]methyl]phenoxy]ethyl]piperidin-1-yl]pent-4-en-1-one.
| Compound Name | 1-[2-[2-[3-[[methyl(quinolin-8-ylmethyl)amino]methyl]phenoxy]ethyl]piperidin-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 45191112 |
| Molecular Formula | C30H37N3O2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | 1-[2-[2-[3-[[methyl(quinolin-8-ylmethyl)amino]methyl]phenoxy]ethyl]piperidin-1-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCCCC1CCOc1cccc(CN(C)Cc2cccc3cccnc23)c1 |
| InChI | InChI=1S/C30H37N3O2/c1-3-4-16-29(34)33-19-6-5-14-27(33)17-20-35-28-15-7-10-24(21-28)22-32(2)23-26-12-8-11-25-13-9-18-31-30(25)26/h3,7-13,15,18,21,27H,1,4-6,14,16-17,19-20,22-23H2,2H3 |
| InChIKey | TZCPNVRITXTUHU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|