C27H34N4O2 — CID 45238800
1-methyl-N-[2-[3-[[methyl(quinolin-8-ylmethyl)amino]methyl]phenoxy]ethyl]piperidine-2-carboxamide (PubChem CID 45238800) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 1-methyl-N-[2-[3-[[methyl(quinolin-8-ylmethyl)amino]methyl]phenoxy]ethyl]piperidine-2-carboxamide.
| Compound Name | 1-methyl-N-[2-[3-[[methyl(quinolin-8-ylmethyl)amino]methyl]phenoxy]ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 45238800 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 1-methyl-N-[2-[3-[[methyl(quinolin-8-ylmethyl)amino]methyl]phenoxy]ethyl]piperidine-2-carboxamide |
| SMILES | CN(Cc1cccc(OCCNC(=O)C2CCCCN2C)c1)Cc1cccc2cccnc12 |
| InChI | InChI=1S/C27H34N4O2/c1-30(20-23-10-6-9-22-11-7-14-28-26(22)23)19-21-8-5-12-24(18-21)33-17-15-29-27(32)25-13-3-4-16-31(25)2/h5-12,14,18,25H,3-4,13,15-17,19-20H2,1-2H3,(H,29,32) |
| InChIKey | LIPVAPWGJJRTOA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|