C28H35N3O2 — CID 125178920
(2R)-1-methyl-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]piperidine-2-carboxamide (PubChem CID 125178920) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is (2R)-1-methyl-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]piperidine-2-carboxamide.
| Compound Name | (2R)-1-methyl-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 125178920 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | (2R)-1-methyl-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]piperidine-2-carboxamide |
| SMILES | CN(Cc1ccc(OCCNC(=O)[C@H]2CCCCN2C)cc1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C28H35N3O2/c1-30(21-24-10-7-9-23-8-3-4-11-26(23)24)20-22-13-15-25(16-14-22)33-19-17-29-28(32)27-12-5-6-18-31(27)2/h3-4,7-11,13-16,27H,5-6,12,17-21H2,1-2H3,(H,29,32)/t27-/m1/s1 |
| InChIKey | UEAYSDLOLFPWIB-HHHXNRCGSA-N |
| XLogP | 4.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|