C29H36N2O3 — CID 45214288
2,2-dimethyl-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]oxane-4-carboxamide (PubChem CID 45214288) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]oxane-4-carboxamide.
| Compound Name | 2,2-dimethyl-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 45214288 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 2,2-dimethyl-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]oxane-4-carboxamide |
| SMILES | CN(Cc1ccc(OCCNC(=O)C2CCOC(C)(C)C2)cc1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C29H36N2O3/c1-29(2)19-24(15-17-34-29)28(32)30-16-18-33-26-13-11-22(12-14-26)20-31(3)21-25-9-6-8-23-7-4-5-10-27(23)25/h4-14,24H,15-21H2,1-3H3,(H,30,32) |
| InChIKey | MWWUEKFAMVCJRX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|