C28H27FN2O2 — CID 26339767
4-fluoro-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]benzamide (PubChem CID 26339767) has the molecular formula C28H27FN2O2 and a molecular weight of 442.53 g/mol. Its IUPAC name is 4-fluoro-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 26339767 |
| Molecular Formula | C28H27FN2O2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 4-fluoro-N-[2-[4-[[methyl(naphthalen-1-ylmethyl)amino]methyl]phenoxy]ethyl]benzamide |
| SMILES | CN(Cc1ccc(OCCNC(=O)c2ccc(F)cc2)cc1)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C28H27FN2O2/c1-31(20-24-7-4-6-22-5-2-3-8-27(22)24)19-21-9-15-26(16-10-21)33-18-17-30-28(32)23-11-13-25(29)14-12-23/h2-16H,17-20H2,1H3,(H,30,32) |
| InChIKey | VTKKJVXTVYOQHX-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|