C19H25ClN4O3 — CID 45191258
methyl 1-[[6-chloro-4-(2-methoxyethylamino)quinazolin-2-yl]methyl]piperidine-2-carboxylate (PubChem CID 45191258) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is methyl 1-[[6-chloro-4-(2-methoxyethylamino)quinazolin-2-yl]methyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[[6-chloro-4-(2-methoxyethylamino)quinazolin-2-yl]methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 45191258 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | methyl 1-[[6-chloro-4-(2-methoxyethylamino)quinazolin-2-yl]methyl]piperidine-2-carboxylate |
| SMILES | COCCNc1nc(CN2CCCCC2C(=O)OC)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H25ClN4O3/c1-26-10-8-21-18-14-11-13(20)6-7-15(14)22-17(23-18)12-24-9-4-3-5-16(24)19(25)27-2/h6-7,11,16H,3-5,8-10,12H2,1-2H3,(H,21,22,23) |
| InChIKey | VYIUPNWHEADZKP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|