About methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate
methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate (PubChem CID 43037481) has the molecular formula C17H18Cl2N2O3
and a molecular weight of 369.25 g/mol. Its IUPAC name is methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate |
| PubChem CID | 43037481 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate |
| SMILES | COC(=O)C1CCCCN1Cc1cc(-c2ccc(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C17H18Cl2N2O3/c1-23-17(22)16-4-2-3-7-21(16)10-12-9-15(20-24-12)13-6-5-11(18)8-14(13)19/h5-6,8-9,16H,2-4,7,10H2,1H3 |
| InChIKey | WYHCWEDPEGUXGG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate?
The IUPAC name of methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate (CID 43037481) is methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate.
What is the SMILES notation for methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate?
The canonical SMILES for methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate is COC(=O)C1CCCCN1Cc1cc(-c2ccc(Cl)cc2Cl)no1.
What is the InChIKey of methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate?
The InChIKey is WYHCWEDPEGUXGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2O3/c1-23-17(22)16-4-2-3-7-21(16)10-12-9-15(20-24-12)13-6-5-11(18)8-14(13)19/h5-6,8-9,16H,2-4,7,10H2,1H3.
What are the key properties of methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate?
methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate has a molecular weight of 369.25 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[3-(2,4-dichlorophenyl)-1,2-oxazol-5-yl]methyl]piperidine-2-carboxylate is sourced from PubChem (CID 43037481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).