C19H33N5O — CID 45191793
N-[3-methyl-1-[7-[(E)-4-methylpent-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]acetamide (PubChem CID 45191793) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is N-[3-methyl-1-[7-[(E)-4-methylpent-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]acetamide.
| Compound Name | N-[3-methyl-1-[7-[(E)-4-methylpent-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]acetamide |
|---|---|
| PubChem CID | 45191793 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | N-[3-methyl-1-[7-[(E)-4-methylpent-2-enyl]-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepin-3-yl]butyl]acetamide |
| SMILES | CC(=O)NC(CC(C)C)c1nnc2n1CCN(C/C=C/C(C)C)CC2 |
| InChI | InChI=1S/C19H33N5O/c1-14(2)7-6-9-23-10-8-18-21-22-19(24(18)12-11-23)17(13-15(3)4)20-16(5)25/h6-7,14-15,17H,8-13H2,1-5H3,(H,20,25)/b7-6+ |
| InChIKey | DULDTWOTUWZLSO-VOTSOKGWSA-N |
| XLogP | 2.57 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|