C25H22FN3S — CID 4519255
N-[1-(4-fluorophenyl)ethylideneamino]-4-phenyl-3-(2-phenylethyl)-1,3-thiazol-2-imine (PubChem CID 4519255) has the molecular formula C25H22FN3S and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethylideneamino]-4-phenyl-3-(2-phenylethyl)-1,3-thiazol-2-imine.
| Compound Name | N-[1-(4-fluorophenyl)ethylideneamino]-4-phenyl-3-(2-phenylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 4519255 |
| Molecular Formula | C25H22FN3S |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethylideneamino]-4-phenyl-3-(2-phenylethyl)-1,3-thiazol-2-imine |
| SMILES | CC(=NN=c1scc(-c2ccccc2)n1CCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H22FN3S/c1-19(21-12-14-23(26)15-13-21)27-28-25-29(17-16-20-8-4-2-5-9-20)24(18-30-25)22-10-6-3-7-11-22/h2-15,18H,16-17H2,1H3 |
| InChIKey | MEHHQFMTQKIONT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|