C28H25N5O3S — CID 4519325
N-[[2-(benzotriazol-1-yl)-1-(4-methylphenyl)-2-phenoxyethylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 4519325) has the molecular formula C28H25N5O3S and a molecular weight of 511.61 g/mol. Its IUPAC name is N-[[2-(benzotriazol-1-yl)-1-(4-methylphenyl)-2-phenoxyethylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[[2-(benzotriazol-1-yl)-1-(4-methylphenyl)-2-phenoxyethylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4519325 |
| Molecular Formula | C28H25N5O3S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | N-[[2-(benzotriazol-1-yl)-1-(4-methylphenyl)-2-phenoxyethylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C(=NNS(=O)(=O)c2ccc(C)cc2)C(Oc2ccccc2)n2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C28H25N5O3S/c1-20-12-16-22(17-13-20)27(30-32-37(34,35)24-18-14-21(2)15-19-24)28(36-23-8-4-3-5-9-23)33-26-11-7-6-10-25(26)29-31-33/h3-19,28,32H,1-2H3 |
| InChIKey | BHCFHGWZYCGELA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|