C25H21N5O2S — CID 86665018
N-[(E)-[2-(benzotriazol-1-yl)-1-naphthalen-1-ylethylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 86665018) has the molecular formula C25H21N5O2S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[(E)-[2-(benzotriazol-1-yl)-1-naphthalen-1-ylethylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[2-(benzotriazol-1-yl)-1-naphthalen-1-ylethylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 86665018 |
| Molecular Formula | C25H21N5O2S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | N-[(E)-[2-(benzotriazol-1-yl)-1-naphthalen-1-ylethylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C(/Cn2nnc3ccccc32)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C25H21N5O2S/c1-18-13-15-20(16-14-18)33(31,32)29-27-24(17-30-25-12-5-4-11-23(25)26-28-30)22-10-6-8-19-7-2-3-9-21(19)22/h2-16,29H,17H2,1H3/b27-24- |
| InChIKey | ZNNMZQFNXAMIRC-PNHLSOANSA-N |
| XLogP | 4.28 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|