C22H22N6O3S — CID 3825973
2-(benzotriazol-1-ylmethyl)-1-(4-methoxyphenyl)-3-(4-methylphenyl)sulfonylguanidine (PubChem CID 3825973) has the molecular formula C22H22N6O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is 2-(benzotriazol-1-ylmethyl)-1-(4-methoxyphenyl)-3-(4-methylphenyl)sulfonylguanidine.
| Compound Name | 2-(benzotriazol-1-ylmethyl)-1-(4-methoxyphenyl)-3-(4-methylphenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 3825973 |
| Molecular Formula | C22H22N6O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-(benzotriazol-1-ylmethyl)-1-(4-methoxyphenyl)-3-(4-methylphenyl)sulfonylguanidine |
| SMILES | COc1ccc(NC(=NCn2nnc3ccccc32)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H22N6O3S/c1-16-7-13-19(14-8-16)32(29,30)26-22(24-17-9-11-18(31-2)12-10-17)23-15-28-21-6-4-3-5-20(21)25-27-28/h3-14H,15H2,1-2H3,(H2,23,24,26) |
| InChIKey | XPBYVNYIZMVMHM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|