C26H24FN3O4S — CID 45194306
methyl 2-[5-(4-fluorophenyl)-4-[1-(2-oxo-2-phenylacetyl)piperidin-3-yl]pyrimidin-2-yl]sulfanylacetate (PubChem CID 45194306) has the molecular formula C26H24FN3O4S and a molecular weight of 493.56 g/mol. Its IUPAC name is methyl 2-[5-(4-fluorophenyl)-4-[1-(2-oxo-2-phenylacetyl)piperidin-3-yl]pyrimidin-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[5-(4-fluorophenyl)-4-[1-(2-oxo-2-phenylacetyl)piperidin-3-yl]pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 45194306 |
| Molecular Formula | C26H24FN3O4S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | methyl 2-[5-(4-fluorophenyl)-4-[1-(2-oxo-2-phenylacetyl)piperidin-3-yl]pyrimidin-2-yl]sulfanylacetate |
| SMILES | COC(=O)CSc1ncc(-c2ccc(F)cc2)c(C2CCCN(C(=O)C(=O)c3ccccc3)C2)n1 |
| InChI | InChI=1S/C26H24FN3O4S/c1-34-22(31)16-35-26-28-14-21(17-9-11-20(27)12-10-17)23(29-26)19-8-5-13-30(15-19)25(33)24(32)18-6-3-2-4-7-18/h2-4,6-7,9-12,14,19H,5,8,13,15-16H2,1H3 |
| InChIKey | ZDKLCCIYKMWAQS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|