C23H31FN2O2 — CID 45195395
1-cyclopentyl-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]piperidin-2-one (PubChem CID 45195395) has the molecular formula C23H31FN2O2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 1-cyclopentyl-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]piperidin-2-one.
| Compound Name | 1-cyclopentyl-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]piperidin-2-one |
|---|---|
| PubChem CID | 45195395 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 1-cyclopentyl-5-[4-[(4-fluorophenyl)methyl]piperidine-1-carbonyl]piperidin-2-one |
| SMILES | O=C(C1CCC(=O)N(C2CCCC2)C1)N1CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H31FN2O2/c24-20-8-5-17(6-9-20)15-18-11-13-25(14-12-18)23(28)19-7-10-22(27)26(16-19)21-3-1-2-4-21/h5-6,8-9,18-19,21H,1-4,7,10-16H2 |
| InChIKey | YBXKXQPZQCUIRI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |