C28H31N3O3 — CID 45195813
1-cyclohexyl-3-N-(1,2-diphenylethyl)-5-N-methyl-4-oxopyridine-3,5-dicarboxamide (PubChem CID 45195813) has the molecular formula C28H31N3O3 and a molecular weight of 457.57 g/mol. Its IUPAC name is 1-cyclohexyl-3-N-(1,2-diphenylethyl)-5-N-methyl-4-oxopyridine-3,5-dicarboxamide.
| Compound Name | 1-cyclohexyl-3-N-(1,2-diphenylethyl)-5-N-methyl-4-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 45195813 |
| Molecular Formula | C28H31N3O3 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 1-cyclohexyl-3-N-(1,2-diphenylethyl)-5-N-methyl-4-oxopyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cn(C2CCCCC2)cc(C(=O)NC(Cc2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C28H31N3O3/c1-29-27(33)23-18-31(22-15-9-4-10-16-22)19-24(26(23)32)28(34)30-25(21-13-7-3-8-14-21)17-20-11-5-2-6-12-20/h2-3,5-8,11-14,18-19,22,25H,4,9-10,15-17H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | UWZDHBIEBNUVFM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |