C23H29N3O3 — CID 26363741
5-N-benzyl-3-N-[(2S)-butan-2-yl]-1-cyclopentyl-4-oxopyridine-3,5-dicarboxamide (PubChem CID 26363741) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 5-N-benzyl-3-N-[(2S)-butan-2-yl]-1-cyclopentyl-4-oxopyridine-3,5-dicarboxamide.
| Compound Name | 5-N-benzyl-3-N-[(2S)-butan-2-yl]-1-cyclopentyl-4-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 26363741 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 5-N-benzyl-3-N-[(2S)-butan-2-yl]-1-cyclopentyl-4-oxopyridine-3,5-dicarboxamide |
| SMILES | CC[C@H](C)NC(=O)c1cn(C2CCCC2)cc(C(=O)NCc2ccccc2)c1=O |
| InChI | InChI=1S/C23H29N3O3/c1-3-16(2)25-23(29)20-15-26(18-11-7-8-12-18)14-19(21(20)27)22(28)24-13-17-9-5-4-6-10-17/h4-6,9-10,14-16,18H,3,7-8,11-13H2,1-2H3,(H,24,28)(H,25,29)/t16-/m0/s1 |
| InChIKey | CNPRFWBMOJRVHQ-INIZCTEOSA-N |
| XLogP | 3.42 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |