C20H31N3O3S — CID 42499673
3-N-[(2S)-butan-2-yl]-1-cyclopentyl-5-N-(3-methylsulfanylpropyl)-4-oxopyridine-3,5-dicarboxamide (PubChem CID 42499673) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is 3-N-[(2S)-butan-2-yl]-1-cyclopentyl-5-N-(3-methylsulfanylpropyl)-4-oxopyridine-3,5-dicarboxamide.
| Compound Name | 3-N-[(2S)-butan-2-yl]-1-cyclopentyl-5-N-(3-methylsulfanylpropyl)-4-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 42499673 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 3-N-[(2S)-butan-2-yl]-1-cyclopentyl-5-N-(3-methylsulfanylpropyl)-4-oxopyridine-3,5-dicarboxamide |
| SMILES | CC[C@H](C)NC(=O)c1cn(C2CCCC2)cc(C(=O)NCCCSC)c1=O |
| InChI | InChI=1S/C20H31N3O3S/c1-4-14(2)22-20(26)17-13-23(15-8-5-6-9-15)12-16(18(17)24)19(25)21-10-7-11-27-3/h12-15H,4-11H2,1-3H3,(H,21,25)(H,22,26)/t14-/m0/s1 |
| InChIKey | WYDGNSLIAVNMNC-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|