C25H34N4O3 — CID 26357797
1-cyclopentyl-3-N-(3-methylbutyl)-4-oxo-5-N-(3-pyridin-4-ylpropyl)pyridine-3,5-dicarboxamide (PubChem CID 26357797) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is 1-cyclopentyl-3-N-(3-methylbutyl)-4-oxo-5-N-(3-pyridin-4-ylpropyl)pyridine-3,5-dicarboxamide.
| Compound Name | 1-cyclopentyl-3-N-(3-methylbutyl)-4-oxo-5-N-(3-pyridin-4-ylpropyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 26357797 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | 1-cyclopentyl-3-N-(3-methylbutyl)-4-oxo-5-N-(3-pyridin-4-ylpropyl)pyridine-3,5-dicarboxamide |
| SMILES | CC(C)CCNC(=O)c1cn(C2CCCC2)cc(C(=O)NCCCc2ccncc2)c1=O |
| InChI | InChI=1S/C25H34N4O3/c1-18(2)9-15-28-25(32)22-17-29(20-7-3-4-8-20)16-21(23(22)30)24(31)27-12-5-6-19-10-13-26-14-11-19/h10-11,13-14,16-18,20H,3-9,12,15H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | IDYUITIJRORZLN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|