C21H33N3O4 — CID 42483113
1-cyclohexyl-5-N-(3-methoxypropyl)-3-N-(2-methylpropyl)-4-oxopyridine-3,5-dicarboxamide (PubChem CID 42483113) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-cyclohexyl-5-N-(3-methoxypropyl)-3-N-(2-methylpropyl)-4-oxopyridine-3,5-dicarboxamide.
| Compound Name | 1-cyclohexyl-5-N-(3-methoxypropyl)-3-N-(2-methylpropyl)-4-oxopyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 42483113 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 1-cyclohexyl-5-N-(3-methoxypropyl)-3-N-(2-methylpropyl)-4-oxopyridine-3,5-dicarboxamide |
| SMILES | COCCCNC(=O)c1cn(C2CCCCC2)cc(C(=O)NCC(C)C)c1=O |
| InChI | InChI=1S/C21H33N3O4/c1-15(2)12-23-21(27)18-14-24(16-8-5-4-6-9-16)13-17(19(18)25)20(26)22-10-7-11-28-3/h13-16H,4-12H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | HSWROBVUJKXTSR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|