C23H36N4O3 — CID 26317253
N-butyl-1-cyclohexyl-5-[(3R)-3-(dimethylamino)pyrrolidine-1-carbonyl]-4-oxopyridine-3-carboxamide (PubChem CID 26317253) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-butyl-1-cyclohexyl-5-[(3R)-3-(dimethylamino)pyrrolidine-1-carbonyl]-4-oxopyridine-3-carboxamide.
| Compound Name | N-butyl-1-cyclohexyl-5-[(3R)-3-(dimethylamino)pyrrolidine-1-carbonyl]-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 26317253 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | N-butyl-1-cyclohexyl-5-[(3R)-3-(dimethylamino)pyrrolidine-1-carbonyl]-4-oxopyridine-3-carboxamide |
| SMILES | CCCCNC(=O)c1cn(C2CCCCC2)cc(C(=O)N2CC[C@@H](N(C)C)C2)c1=O |
| InChI | InChI=1S/C23H36N4O3/c1-4-5-12-24-22(29)19-15-27(17-9-7-6-8-10-17)16-20(21(19)28)23(30)26-13-11-18(14-26)25(2)3/h15-18H,4-14H2,1-3H3,(H,24,29)/t18-/m1/s1 |
| InChIKey | UONKOPXWKBKQEP-GOSISDBHSA-N |
| XLogP | 2.66 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|