C23H22N6O — CID 45196482
(2-methylpiperidin-1-yl)-[3-quinolin-5-yl-5-(tetrazol-1-yl)phenyl]methanone (PubChem CID 45196482) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is (2-methylpiperidin-1-yl)-[3-quinolin-5-yl-5-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | (2-methylpiperidin-1-yl)-[3-quinolin-5-yl-5-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 45196482 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (2-methylpiperidin-1-yl)-[3-quinolin-5-yl-5-(tetrazol-1-yl)phenyl]methanone |
| SMILES | CC1CCCCN1C(=O)c1cc(-c2cccc3ncccc23)cc(-n2cnnn2)c1 |
| InChI | InChI=1S/C23H22N6O/c1-16-6-2-3-11-28(16)23(30)18-12-17(13-19(14-18)29-15-25-26-27-29)20-7-4-9-22-21(20)8-5-10-24-22/h4-5,7-10,12-16H,2-3,6,11H2,1H3 |
| InChIKey | KOITYRSNRJHFFI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |