C21H24N4OS — CID 45197403
1-[1-[5-methyl-1-(2-methylphenyl)pyrazol-4-yl]ethyl]-3-(4-methylsulfanylphenyl)urea (PubChem CID 45197403) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 1-[1-[5-methyl-1-(2-methylphenyl)pyrazol-4-yl]ethyl]-3-(4-methylsulfanylphenyl)urea.
| Compound Name | 1-[1-[5-methyl-1-(2-methylphenyl)pyrazol-4-yl]ethyl]-3-(4-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 45197403 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-[1-[5-methyl-1-(2-methylphenyl)pyrazol-4-yl]ethyl]-3-(4-methylsulfanylphenyl)urea |
| SMILES | CSc1ccc(NC(=O)NC(C)c2cnn(-c3ccccc3C)c2C)cc1 |
| InChI | InChI=1S/C21H24N4OS/c1-14-7-5-6-8-20(14)25-16(3)19(13-22-25)15(2)23-21(26)24-17-9-11-18(27-4)12-10-17/h5-13,15H,1-4H3,(H2,23,24,26) |
| InChIKey | GCRRBAXKOSTZBE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |