C26H30FN3O4 — CID 45198121
5-N-[2-(3-fluorophenyl)ethyl]-4-oxo-1-(oxolan-2-ylmethyl)-3-N,3-N-bis(prop-2-enyl)pyridine-3,5-dicarboxamide (PubChem CID 45198121) has the molecular formula C26H30FN3O4 and a molecular weight of 467.54 g/mol. Its IUPAC name is 5-N-[2-(3-fluorophenyl)ethyl]-4-oxo-1-(oxolan-2-ylmethyl)-3-N,3-N-bis(prop-2-enyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-[2-(3-fluorophenyl)ethyl]-4-oxo-1-(oxolan-2-ylmethyl)-3-N,3-N-bis(prop-2-enyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 45198121 |
| Molecular Formula | C26H30FN3O4 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 5-N-[2-(3-fluorophenyl)ethyl]-4-oxo-1-(oxolan-2-ylmethyl)-3-N,3-N-bis(prop-2-enyl)pyridine-3,5-dicarboxamide |
| SMILES | C=CCN(CC=C)C(=O)c1cn(CC2CCCO2)cc(C(=O)NCCc2cccc(F)c2)c1=O |
| InChI | InChI=1S/C26H30FN3O4/c1-3-12-30(13-4-2)26(33)23-18-29(16-21-9-6-14-34-21)17-22(24(23)31)25(32)28-11-10-19-7-5-8-20(27)15-19/h3-5,7-8,15,17-18,21H,1-2,6,9-14,16H2,(H,28,32) |
| InChIKey | ZFGKIWVROYOLIV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|