C26H34FN3O5 — CID 45193580
3-N-[2-(3-fluorophenyl)ethyl]-4-oxo-1-(oxolan-2-ylmethyl)-5-N-(3-propan-2-yloxypropyl)pyridine-3,5-dicarboxamide (PubChem CID 45193580) has the molecular formula C26H34FN3O5 and a molecular weight of 487.57 g/mol. Its IUPAC name is 3-N-[2-(3-fluorophenyl)ethyl]-4-oxo-1-(oxolan-2-ylmethyl)-5-N-(3-propan-2-yloxypropyl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-[2-(3-fluorophenyl)ethyl]-4-oxo-1-(oxolan-2-ylmethyl)-5-N-(3-propan-2-yloxypropyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 45193580 |
| Molecular Formula | C26H34FN3O5 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 3-N-[2-(3-fluorophenyl)ethyl]-4-oxo-1-(oxolan-2-ylmethyl)-5-N-(3-propan-2-yloxypropyl)pyridine-3,5-dicarboxamide |
| SMILES | CC(C)OCCCNC(=O)c1cn(CC2CCCO2)cc(C(=O)NCCc2cccc(F)c2)c1=O |
| InChI | InChI=1S/C26H34FN3O5/c1-18(2)34-13-5-10-28-25(32)22-16-30(15-21-8-4-12-35-21)17-23(24(22)31)26(33)29-11-9-19-6-3-7-20(27)14-19/h3,6-7,14,16-18,21H,4-5,8-13,15H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | UFYRJEFTLDONLD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|