C29H33N5O2 — CID 45198692
2-(benzimidazol-1-yl)-N-[2-[4-[(4-phenylpiperazin-1-yl)methyl]phenoxy]propyl]acetamide (PubChem CID 45198692) has the molecular formula C29H33N5O2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)-N-[2-[4-[(4-phenylpiperazin-1-yl)methyl]phenoxy]propyl]acetamide.
| Compound Name | 2-(benzimidazol-1-yl)-N-[2-[4-[(4-phenylpiperazin-1-yl)methyl]phenoxy]propyl]acetamide |
|---|---|
| PubChem CID | 45198692 |
| Molecular Formula | C29H33N5O2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 2-(benzimidazol-1-yl)-N-[2-[4-[(4-phenylpiperazin-1-yl)methyl]phenoxy]propyl]acetamide |
| SMILES | CC(CNC(=O)Cn1cnc2ccccc21)Oc1ccc(CN2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H33N5O2/c1-23(19-30-29(35)21-34-22-31-27-9-5-6-10-28(27)34)36-26-13-11-24(12-14-26)20-32-15-17-33(18-16-32)25-7-3-2-4-8-25/h2-14,22-23H,15-21H2,1H3,(H,30,35) |
| InChIKey | BFEQNIWZDFWXHH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |