C23H28N4O2S — CID 45201574
1-[2-(cyclohexen-1-yl)acetyl]-N-[3-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]piperidine-2-carboxamide (PubChem CID 45201574) has the molecular formula C23H28N4O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)acetyl]-N-[3-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]piperidine-2-carboxamide.
| Compound Name | 1-[2-(cyclohexen-1-yl)acetyl]-N-[3-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 45201574 |
| Molecular Formula | C23H28N4O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)acetyl]-N-[3-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]piperidine-2-carboxamide |
| SMILES | Cc1nnc(-c2cccc(NC(=O)C3CCCCN3C(=O)CC3=CCCCC3)c2)s1 |
| InChI | InChI=1S/C23H28N4O2S/c1-16-25-26-23(30-16)18-10-7-11-19(15-18)24-22(29)20-12-5-6-13-27(20)21(28)14-17-8-3-2-4-9-17/h7-8,10-11,15,20H,2-6,9,12-14H2,1H3,(H,24,29) |
| InChIKey | AQXFBQZGIILCSD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|