C20H25N3O4 — CID 45201600
N-(3-hydroxy-3-prop-2-enylhex-5-en-2-yl)-5-[(6-methyl-3-pyridinyl)oxymethyl]-1,2-oxazole-3-carboxamide (PubChem CID 45201600) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(3-hydroxy-3-prop-2-enylhex-5-en-2-yl)-5-[(6-methyl-3-pyridinyl)oxymethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-(3-hydroxy-3-prop-2-enylhex-5-en-2-yl)-5-[(6-methyl-3-pyridinyl)oxymethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 45201600 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-(3-hydroxy-3-prop-2-enylhex-5-en-2-yl)-5-[(6-methyl-3-pyridinyl)oxymethyl]-1,2-oxazole-3-carboxamide |
| SMILES | C=CCC(O)(CC=C)C(C)NC(=O)c1cc(COc2ccc(C)nc2)on1 |
| InChI | InChI=1S/C20H25N3O4/c1-5-9-20(25,10-6-2)15(4)22-19(24)18-11-17(27-23-18)13-26-16-8-7-14(3)21-12-16/h5-8,11-12,15,25H,1-2,9-10,13H2,3-4H3,(H,22,24) |
| InChIKey | AIAAUEMDYHDXSK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|