About 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide
5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide (PubChem CID 53110030) has the molecular formula C22H21N3O4
and a molecular weight of 391.43 g/mol. Its IUPAC name is 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 53110030 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide |
| SMILES | C=CCNC(=O)c1cc(COc2ccc(NC(=O)c3ccc(C)cc3)cc2)on1 |
| InChI | InChI=1S/C22H21N3O4/c1-3-12-23-22(27)20-13-19(29-25-20)14-28-18-10-8-17(9-11-18)24-21(26)16-6-4-15(2)5-7-16/h3-11,13H,1,12,14H2,2H3,(H,23,27)(H,24,26) |
| InChIKey | SIIBBICXCOWVIJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide (CID 53110030) is 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide is C=CCNC(=O)c1cc(COc2ccc(NC(=O)c3ccc(C)cc3)cc2)on1.
What is the InChIKey of 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide?
The InChIKey is SIIBBICXCOWVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O4/c1-3-12-23-22(27)20-13-19(29-25-20)14-28-18-10-8-17(9-11-18)24-21(26)16-6-4-15(2)5-7-16/h3-11,13H,1,12,14H2,2H3,(H,23,27)(H,24,26).
What are the key properties of 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide?
5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide has a molecular weight of 391.43 g/mol, XLogP of 3.73, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-[(4-methylbenzoyl)amino]phenoxy]methyl]-N-prop-2-enyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 53110030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).