C21H20ClN3O5 — CID 53110324
5-[[4-[(4-chlorobenzoyl)amino]phenoxy]methyl]-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide (PubChem CID 53110324) has the molecular formula C21H20ClN3O5 and a molecular weight of 429.86 g/mol. Its IUPAC name is 5-[[4-[(4-chlorobenzoyl)amino]phenoxy]methyl]-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-[[4-[(4-chlorobenzoyl)amino]phenoxy]methyl]-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 53110324 |
| Molecular Formula | C21H20ClN3O5 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 5-[[4-[(4-chlorobenzoyl)amino]phenoxy]methyl]-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCCNC(=O)c1cc(COc2ccc(NC(=O)c3ccc(Cl)cc3)cc2)on1 |
| InChI | InChI=1S/C21H20ClN3O5/c1-28-11-10-23-21(27)19-12-18(30-25-19)13-29-17-8-6-16(7-9-17)24-20(26)14-2-4-15(22)5-3-14/h2-9,12H,10-11,13H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | MWNHHSQKCRCAQH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|