C22H31ClN2O4 — CID 45202036
1-[4-[4-chloro-2-(3-propoxypiperidine-1-carbonyl)phenoxy]piperidin-1-yl]ethanone (PubChem CID 45202036) has the molecular formula C22H31ClN2O4 and a molecular weight of 422.95 g/mol. Its IUPAC name is 1-[4-[4-chloro-2-(3-propoxypiperidine-1-carbonyl)phenoxy]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[4-chloro-2-(3-propoxypiperidine-1-carbonyl)phenoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 45202036 |
| Molecular Formula | C22H31ClN2O4 |
| Molecular Weight | 422.95 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-[4-[4-chloro-2-(3-propoxypiperidine-1-carbonyl)phenoxy]piperidin-1-yl]ethanone |
| SMILES | CCCOC1CCCN(C(=O)c2cc(Cl)ccc2OC2CCN(C(C)=O)CC2)C1 |
| InChI | InChI=1S/C22H31ClN2O4/c1-3-13-28-19-5-4-10-25(15-19)22(27)20-14-17(23)6-7-21(20)29-18-8-11-24(12-9-18)16(2)26/h6-7,14,18-19H,3-5,8-13,15H2,1-2H3 |
| InChIKey | NCMPWSLGQXOFKQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |