C21H35N5O — CID 45202562
N-[1-[2-[cyclohexyl(methyl)amino]-4-methylpyrimidin-5-yl]ethyl]-2-piperidin-1-ylacetamide (PubChem CID 45202562) has the molecular formula C21H35N5O and a molecular weight of 373.55 g/mol. Its IUPAC name is N-[1-[2-[cyclohexyl(methyl)amino]-4-methylpyrimidin-5-yl]ethyl]-2-piperidin-1-ylacetamide.
| Compound Name | N-[1-[2-[cyclohexyl(methyl)amino]-4-methylpyrimidin-5-yl]ethyl]-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 45202562 |
| Molecular Formula | C21H35N5O |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | N-[1-[2-[cyclohexyl(methyl)amino]-4-methylpyrimidin-5-yl]ethyl]-2-piperidin-1-ylacetamide |
| SMILES | Cc1nc(N(C)C2CCCCC2)ncc1C(C)NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C21H35N5O/c1-16(23-20(27)15-26-12-8-5-9-13-26)19-14-22-21(24-17(19)2)25(3)18-10-6-4-7-11-18/h14,16,18H,4-13,15H2,1-3H3,(H,23,27) |
| InChIKey | XAPGNRICEIBWGD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |