C24H19ClNO4- — CID 4520507
3-(3-chloro-4,5-diethoxyphenyl)benzo[f]quinoline-1-carboxylate (PubChem CID 4520507) has the molecular formula C24H19ClNO4- and a molecular weight of 420.87 g/mol. Its IUPAC name is 3-(3-chloro-4,5-diethoxyphenyl)benzo[f]quinoline-1-carboxylate.
| Compound Name | 3-(3-chloro-4,5-diethoxyphenyl)benzo[f]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 4520507 |
| Molecular Formula | C24H19ClNO4- |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 3-(3-chloro-4,5-diethoxyphenyl)benzo[f]quinoline-1-carboxylate |
| SMILES | CCOc1cc(-c2cc(C(=O)[O-])c3c(ccc4ccccc43)n2)cc(Cl)c1OCC |
| InChI | InChI=1S/C24H20ClNO4/c1-3-29-21-12-15(11-18(25)23(21)30-4-2)20-13-17(24(27)28)22-16-8-6-5-7-14(16)9-10-19(22)26-20/h5-13H,3-4H2,1-2H3,(H,27,28)/p-1 |
| InChIKey | GKMAMZFXAYOHNU-UHFFFAOYSA-M |
| XLogP | 4.87 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|