C29H22N5O6- — CID 7102670
3-[3-methoxy-4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyphenyl]benzo[f]quinoline-1-carboxylate (PubChem CID 7102670) has the molecular formula C29H22N5O6- and a molecular weight of 536.52 g/mol. Its IUPAC name is 3-[3-methoxy-4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyphenyl]benzo[f]quinoline-1-carboxylate.
| Compound Name | 3-[3-methoxy-4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyphenyl]benzo[f]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 7102670 |
| Molecular Formula | C29H22N5O6- |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 3-[3-methoxy-4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)oxyphenyl]benzo[f]quinoline-1-carboxylate |
| SMILES | COc1cc(-c2cc(C(=O)[O-])c3c(ccc4ccccc43)n2)ccc1Oc1nc2c(c(=O)n(C)c(=O)n2C)n1C |
| InChI | InChI=1S/C29H23N5O6/c1-32-24-25(33(2)29(38)34(3)26(24)35)31-28(32)40-21-12-10-16(13-22(21)39-4)20-14-18(27(36)37)23-17-8-6-5-7-15(17)9-11-19(23)30-20/h5-14H,1-4H3,(H,36,37)/p-1 |
| InChIKey | RBCIGNOERDIOIY-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 133.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|