C21H29N5O4S2 — CID 4520599
N-[3-[4-ethyl-5-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 4520599) has the molecular formula C21H29N5O4S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is N-[3-[4-ethyl-5-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[4-ethyl-5-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 4520599 |
| Molecular Formula | C21H29N5O4S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | N-[3-[4-ethyl-5-[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl]sulfanyl-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CCn1c(CCCNC(C)=O)nnc1SCC(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H29N5O4S2/c1-3-26-20(7-6-12-22-16(2)27)23-24-21(26)31-15-19(28)17-8-10-18(11-9-17)32(29,30)25-13-4-5-14-25/h8-11H,3-7,12-15H2,1-2H3,(H,22,27) |
| InChIKey | VMMWQLNNBGEPJZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|