C26H31N5O4S2 — CID 5058003
N-[3-[5-[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 5058003) has the molecular formula C26H31N5O4S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is N-[3-[5-[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[5-[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 5058003 |
| Molecular Formula | C26H31N5O4S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | N-[3-[5-[2-oxo-2-(4-piperidin-1-ylsulfonylphenyl)ethyl]sulfanyl-4-phenyl-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1nnc(SCC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H31N5O4S2/c1-20(32)27-16-8-11-25-28-29-26(31(25)22-9-4-2-5-10-22)36-19-24(33)21-12-14-23(15-13-21)37(34,35)30-17-6-3-7-18-30/h2,4-5,9-10,12-15H,3,6-8,11,16-19H2,1H3,(H,27,32) |
| InChIKey | PXWGTOMNNKCPFR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|