C25H31N3O3 — CID 45206179
2-[1-[(3-methoxyphenyl)methyl]-4-[(8-methoxyquinolin-2-yl)methyl]piperazin-2-yl]ethanol (PubChem CID 45206179) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[1-[(3-methoxyphenyl)methyl]-4-[(8-methoxyquinolin-2-yl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[1-[(3-methoxyphenyl)methyl]-4-[(8-methoxyquinolin-2-yl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45206179 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-[1-[(3-methoxyphenyl)methyl]-4-[(8-methoxyquinolin-2-yl)methyl]piperazin-2-yl]ethanol |
| SMILES | COc1cccc(CN2CCN(Cc3ccc4cccc(OC)c4n3)CC2CCO)c1 |
| InChI | InChI=1S/C25H31N3O3/c1-30-23-7-3-5-19(15-23)16-28-13-12-27(18-22(28)11-14-29)17-21-10-9-20-6-4-8-24(31-2)25(20)26-21/h3-10,15,22,29H,11-14,16-18H2,1-2H3 |
| InChIKey | LJQGUUGLWBLKDS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |